C24H17Cl2NO4 — CID 18829839
4-chloro-N-[2-(3-chloro-4-ethoxybenzoyl)-1-benzofuran-3-yl]benzamide (PubChem CID 18829839) has the molecular formula C24H17Cl2NO4 and a molecular weight of 454.31 g/mol. Its IUPAC name is 4-chloro-N-[2-(3-chloro-4-ethoxybenzoyl)-1-benzofuran-3-yl]benzamide.
| Compound Name | 4-chloro-N-[2-(3-chloro-4-ethoxybenzoyl)-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 18829839 |
| Molecular Formula | C24H17Cl2NO4 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 4-chloro-N-[2-(3-chloro-4-ethoxybenzoyl)-1-benzofuran-3-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)c2oc3ccccc3c2NC(=O)c2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C24H17Cl2NO4/c1-2-30-20-12-9-15(13-18(20)26)22(28)23-21(17-5-3-4-6-19(17)31-23)27-24(29)14-7-10-16(25)11-8-14/h3-13H,2H2,1H3,(H,27,29) |
| InChIKey | UWXNYKVPTJGNGE-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |