C23H15ClN2O6 — CID 1423526
N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-nitrobenzamide (PubChem CID 1423526) has the molecular formula C23H15ClN2O6 and a molecular weight of 450.83 g/mol. Its IUPAC name is N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-nitrobenzamide.
| Compound Name | N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 1423526 |
| Molecular Formula | C23H15ClN2O6 |
| Molecular Weight | 450.83 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-nitrobenzamide |
| SMILES | COc1ccc(C(=O)c2oc3ccccc3c2NC(=O)c2ccc([N+](=O)[O-])cc2)cc1Cl |
| InChI | InChI=1S/C23H15ClN2O6/c1-31-19-11-8-14(12-17(19)24)21(27)22-20(16-4-2-3-5-18(16)32-22)25-23(28)13-6-9-15(10-7-13)26(29)30/h2-12H,1H3,(H,25,28) |
| InChIKey | VFONXWIUPYBIBJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.83 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|