C24H18ClNO4 — CID 18829831
N-[2-(3-chloro-4-ethoxybenzoyl)-1-benzofuran-3-yl]benzamide (PubChem CID 18829831) has the molecular formula C24H18ClNO4 and a molecular weight of 419.86 g/mol. Its IUPAC name is N-[2-(3-chloro-4-ethoxybenzoyl)-1-benzofuran-3-yl]benzamide.
| Compound Name | N-[2-(3-chloro-4-ethoxybenzoyl)-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 18829831 |
| Molecular Formula | C24H18ClNO4 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N-[2-(3-chloro-4-ethoxybenzoyl)-1-benzofuran-3-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)c2oc3ccccc3c2NC(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H18ClNO4/c1-2-29-20-13-12-16(14-18(20)25)22(27)23-21(17-10-6-7-11-19(17)30-23)26-24(28)15-8-4-3-5-9-15/h3-14H,2H2,1H3,(H,26,28) |
| InChIKey | KUUQZHYNUFTOMD-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |