C24H17ClN2O6 — CID 18847930
4-chloro-N-[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]-3-nitrobenzamide (PubChem CID 18847930) has the molecular formula C24H17ClN2O6 and a molecular weight of 464.86 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18847930 |
| Molecular Formula | C24H17ClN2O6 |
| Molecular Weight | 464.86 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 4-chloro-N-[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)c2oc3ccccc3c2NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H17ClN2O6/c1-2-32-16-10-7-14(8-11-16)22(28)23-21(17-5-3-4-6-20(17)33-23)26-24(29)15-9-12-18(25)19(13-15)27(30)31/h3-13H,2H2,1H3,(H,26,29) |
| InChIKey | SXGRBYJTPRGONC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.86 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|