C25H19Cl2NO5 — CID 18848197
3,5-dichloro-N-[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]-4-methoxybenzamide (PubChem CID 18848197) has the molecular formula C25H19Cl2NO5 and a molecular weight of 484.34 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 18848197 |
| Molecular Formula | C25H19Cl2NO5 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 3,5-dichloro-N-[2-(4-ethoxybenzoyl)-1-benzofuran-3-yl]-4-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)c2oc3ccccc3c2NC(=O)c2cc(Cl)c(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H19Cl2NO5/c1-3-32-16-10-8-14(9-11-16)22(29)24-21(17-6-4-5-7-20(17)33-24)28-25(30)15-12-18(26)23(31-2)19(27)13-15/h4-13H,3H2,1-2H3,(H,28,30) |
| InChIKey | UNLVELSKYNYYTJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |