C29H26Cl3NO5 — CID 18848207
3,5-dichloro-N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-hexoxybenzamide (PubChem CID 18848207) has the molecular formula C29H26Cl3NO5 and a molecular weight of 574.89 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-hexoxybenzamide.
| Compound Name | 3,5-dichloro-N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 18848207 |
| Molecular Formula | C29H26Cl3NO5 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | 3,5-dichloro-N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1c(Cl)cc(C(=O)Nc2c(C(=O)c3ccc(OC)c(Cl)c3)oc3ccccc23)cc1Cl |
| InChI | InChI=1S/C29H26Cl3NO5/c1-3-4-5-8-13-37-27-21(31)15-18(16-22(27)32)29(35)33-25-19-9-6-7-10-23(19)38-28(25)26(34)17-11-12-24(36-2)20(30)14-17/h6-7,9-12,14-16H,3-5,8,13H2,1-2H3,(H,33,35) |
| InChIKey | IUAINIQZOJCAOY-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|