C27H22BrCl2NO5 — CID 19114904
N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-butoxy-3,5-dichlorobenzamide (PubChem CID 19114904) has the molecular formula C27H22BrCl2NO5 and a molecular weight of 591.29 g/mol. Its IUPAC name is N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-butoxy-3,5-dichlorobenzamide.
| Compound Name | N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-butoxy-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 19114904 |
| Molecular Formula | C27H22BrCl2NO5 |
| Molecular Weight | 591.29 g/mol |
| Exact Mass | 589.01 |
| IUPAC Name | N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]-4-butoxy-3,5-dichlorobenzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2c(C(=O)c3ccc(OC)c(Br)c3)oc3ccccc23)cc1Cl |
| InChI | InChI=1S/C27H22BrCl2NO5/c1-3-4-11-35-25-19(29)13-16(14-20(25)30)27(33)31-23-17-7-5-6-8-21(17)36-26(23)24(32)15-9-10-22(34-2)18(28)12-15/h5-10,12-14H,3-4,11H2,1-2H3,(H,31,33) |
| InChIKey | QTQIDDJGQYXCCL-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.29 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|