C21H14BrNO4S — CID 19114824
N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]thiophene-2-carboxamide (PubChem CID 19114824) has the molecular formula C21H14BrNO4S and a molecular weight of 456.32 g/mol. Its IUPAC name is N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19114824 |
| Molecular Formula | C21H14BrNO4S |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]thiophene-2-carboxamide |
| SMILES | COc1ccc(C(=O)c2oc3ccccc3c2NC(=O)c2cccs2)cc1Br |
| InChI | InChI=1S/C21H14BrNO4S/c1-26-16-9-8-12(11-14(16)22)19(24)20-18(13-5-2-3-6-15(13)27-20)23-21(25)17-7-4-10-28-17/h2-11H,1H3,(H,23,25) |
| InChIKey | YDRANOQDXWLTBI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |