C25H18BrNO4 — CID 19114821
(E)-N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]-3-phenylprop-2-enamide (PubChem CID 19114821) has the molecular formula C25H18BrNO4 and a molecular weight of 476.33 g/mol. Its IUPAC name is (E)-N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 19114821 |
| Molecular Formula | C25H18BrNO4 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | (E)-N-[2-(3-bromo-4-methoxybenzoyl)-1-benzofuran-3-yl]-3-phenylprop-2-enamide |
| SMILES | COc1ccc(C(=O)c2oc3ccccc3c2NC(=O)/C=C/c2ccccc2)cc1Br |
| InChI | InChI=1S/C25H18BrNO4/c1-30-21-13-12-17(15-19(21)26)24(29)25-23(18-9-5-6-10-20(18)31-25)27-22(28)14-11-16-7-3-2-4-8-16/h2-15H,1H3,(H,27,28)/b14-11+ |
| InChIKey | FWTWHKCLIPSKQH-SDNWHVSQSA-N |
| XLogP | 6.09 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|