C25H19NO4 — CID 1341670
(E)-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]-3-phenylprop-2-enamide (PubChem CID 1341670) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is (E)-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 1341670 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (E)-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]-3-phenylprop-2-enamide |
| SMILES | COc1ccc(C(=O)c2oc3ccccc3c2NC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19NO4/c1-29-19-14-12-18(13-15-19)24(28)25-23(20-9-5-6-10-21(20)30-25)26-22(27)16-11-17-7-3-2-4-8-17/h2-16H,1H3,(H,26,27)/b16-11+ |
| InChIKey | JNLDNWQKUQYEFK-LFIBNONCSA-N |
| XLogP | 5.32 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|