C25H18FNO3 — CID 3445612
N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 3445612) has the molecular formula C25H18FNO3 and a molecular weight of 399.42 g/mol. Its IUPAC name is N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3445612 |
| Molecular Formula | C25H18FNO3 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)Nc2c(C(=O)c3ccc(F)cc3)oc3ccccc23)cc1 |
| InChI | InChI=1S/C25H18FNO3/c1-16-6-8-17(9-7-16)10-15-22(28)27-23-20-4-2-3-5-21(20)30-25(23)24(29)18-11-13-19(26)14-12-18/h2-15H,1H3,(H,27,28) |
| InChIKey | NJWGXRVOZUJNPH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|