C24H18N2O7 — CID 1418905
N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]-2-(4-nitrophenoxy)acetamide (PubChem CID 1418905) has the molecular formula C24H18N2O7 and a molecular weight of 446.42 g/mol. Its IUPAC name is N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 1418905 |
| Molecular Formula | C24H18N2O7 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]-2-(4-nitrophenoxy)acetamide |
| SMILES | COc1ccc(C(=O)c2oc3ccccc3c2NC(=O)COc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H18N2O7/c1-31-17-10-6-15(7-11-17)23(28)24-22(19-4-2-3-5-20(19)33-24)25-21(27)14-32-18-12-8-16(9-13-18)26(29)30/h2-13H,14H2,1H3,(H,25,27) |
| InChIKey | JELHJEVKKOPHBL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|