C21H21NO4 — CID 4289355
N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]pentanamide (PubChem CID 4289355) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]pentanamide.
| Compound Name | N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]pentanamide |
|---|---|
| PubChem CID | 4289355 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1c(C(=O)c2ccc(OC)cc2)oc2ccccc12 |
| InChI | InChI=1S/C21H21NO4/c1-3-4-9-18(23)22-19-16-7-5-6-8-17(16)26-21(19)20(24)14-10-12-15(25-2)13-11-14/h5-8,10-13H,3-4,9H2,1-2H3,(H,22,23) |
| InChIKey | HVKJRESTRYQFQK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |