C30H29Cl2NO5 — CID 18848189
3,5-dichloro-4-heptoxy-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]benzamide (PubChem CID 18848189) has the molecular formula C30H29Cl2NO5 and a molecular weight of 554.47 g/mol. Its IUPAC name is 3,5-dichloro-4-heptoxy-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]benzamide.
| Compound Name | 3,5-dichloro-4-heptoxy-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 18848189 |
| Molecular Formula | C30H29Cl2NO5 |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 3,5-dichloro-4-heptoxy-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]benzamide |
| SMILES | CCCCCCCOc1c(Cl)cc(C(=O)Nc2c(C(=O)c3ccc(OC)cc3)oc3ccccc23)cc1Cl |
| InChI | InChI=1S/C30H29Cl2NO5/c1-3-4-5-6-9-16-37-28-23(31)17-20(18-24(28)32)30(35)33-26-22-10-7-8-11-25(22)38-29(26)27(34)19-12-14-21(36-2)15-13-19/h7-8,10-15,17-18H,3-6,9,16H2,1-2H3,(H,33,35) |
| InChIKey | OQJHNUGXWFBPEM-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|