C24H16BrCl2NO4 — CID 3445856
N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]-3,5-dichloro-4-ethoxybenzamide (PubChem CID 3445856) has the molecular formula C24H16BrCl2NO4 and a molecular weight of 533.21 g/mol. Its IUPAC name is N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]-3,5-dichloro-4-ethoxybenzamide.
| Compound Name | N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]-3,5-dichloro-4-ethoxybenzamide |
|---|---|
| PubChem CID | 3445856 |
| Molecular Formula | C24H16BrCl2NO4 |
| Molecular Weight | 533.21 g/mol |
| Exact Mass | 530.96 |
| IUPAC Name | N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]-3,5-dichloro-4-ethoxybenzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2c(C(=O)c3ccc(Br)cc3)oc3ccccc23)cc1Cl |
| InChI | InChI=1S/C24H16BrCl2NO4/c1-2-31-22-17(26)11-14(12-18(22)27)24(30)28-20-16-5-3-4-6-19(16)32-23(20)21(29)13-7-9-15(25)10-8-13/h3-12H,2H2,1H3,(H,28,30) |
| InChIKey | UHBQIPGCFQQHOZ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.21 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |