C29H26Cl2FNO4 — CID 18848177
3,5-dichloro-N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-4-heptoxybenzamide (PubChem CID 18848177) has the molecular formula C29H26Cl2FNO4 and a molecular weight of 542.43 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-4-heptoxybenzamide.
| Compound Name | 3,5-dichloro-N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 18848177 |
| Molecular Formula | C29H26Cl2FNO4 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 3,5-dichloro-N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1c(Cl)cc(C(=O)Nc2c(C(=O)c3ccc(F)cc3)oc3ccccc23)cc1Cl |
| InChI | InChI=1S/C29H26Cl2FNO4/c1-2-3-4-5-8-15-36-27-22(30)16-19(17-23(27)31)29(35)33-25-21-9-6-7-10-24(21)37-28(25)26(34)18-11-13-20(32)14-12-18/h6-7,9-14,16-17H,2-5,8,15H2,1H3,(H,33,35) |
| InChIKey | DOXXBQPRDWNPEH-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|