C23H26ClNO2 — CID 110827004
(4-chlorophenyl)-[3-(octylamino)-1-benzofuran-2-yl]methanone (PubChem CID 110827004) has the molecular formula C23H26ClNO2 and a molecular weight of 383.92 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-(octylamino)-1-benzofuran-2-yl]methanone.
| Compound Name | (4-chlorophenyl)-[3-(octylamino)-1-benzofuran-2-yl]methanone |
|---|---|
| PubChem CID | 110827004 |
| Molecular Formula | C23H26ClNO2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (4-chlorophenyl)-[3-(octylamino)-1-benzofuran-2-yl]methanone |
| SMILES | CCCCCCCCNc1c(C(=O)c2ccc(Cl)cc2)oc2ccccc12 |
| InChI | InChI=1S/C23H26ClNO2/c1-2-3-4-5-6-9-16-25-21-19-10-7-8-11-20(19)27-23(21)22(26)17-12-14-18(24)15-13-17/h7-8,10-15,25H,2-6,9,16H2,1H3 |
| InChIKey | JJSSLLGGIJLZMU-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|