C20H18ClNO3 — CID 4067768
N-[2-(4-chlorobenzoyl)-1-benzofuran-3-yl]-2,2-dimethylpropanamide (PubChem CID 4067768) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is N-[2-(4-chlorobenzoyl)-1-benzofuran-3-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(4-chlorobenzoyl)-1-benzofuran-3-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 4067768 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[2-(4-chlorobenzoyl)-1-benzofuran-3-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1c(C(=O)c2ccc(Cl)cc2)oc2ccccc12 |
| InChI | InChI=1S/C20H18ClNO3/c1-20(2,3)19(24)22-16-14-6-4-5-7-15(14)25-18(16)17(23)12-8-10-13(21)11-9-12/h4-11H,1-3H3,(H,22,24) |
| InChIKey | WPRYSTSHBHOZHF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |