C23H15Cl2NO3 — CID 110825260
2-[[2-(4-chlorobenzoyl)-1-benzofuran-3-yl]amino]-1-(4-chlorophenyl)ethanone (PubChem CID 110825260) has the molecular formula C23H15Cl2NO3 and a molecular weight of 424.28 g/mol. Its IUPAC name is 2-[[2-(4-chlorobenzoyl)-1-benzofuran-3-yl]amino]-1-(4-chlorophenyl)ethanone.
| Compound Name | 2-[[2-(4-chlorobenzoyl)-1-benzofuran-3-yl]amino]-1-(4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 110825260 |
| Molecular Formula | C23H15Cl2NO3 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 2-[[2-(4-chlorobenzoyl)-1-benzofuran-3-yl]amino]-1-(4-chlorophenyl)ethanone |
| SMILES | O=C(CNc1c(C(=O)c2ccc(Cl)cc2)oc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H15Cl2NO3/c24-16-9-5-14(6-10-16)19(27)13-26-21-18-3-1-2-4-20(18)29-23(21)22(28)15-7-11-17(25)12-8-15/h1-12,26H,13H2 |
| InChIKey | HUKGVZSJEDYFJI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |