C25H20FNO4 — CID 110825664
2-[[2-(3-fluoro-4-methylbenzoyl)-1-benzofuran-3-yl]amino]-1-(4-methoxyphenyl)ethanone (PubChem CID 110825664) has the molecular formula C25H20FNO4 and a molecular weight of 417.44 g/mol. Its IUPAC name is 2-[[2-(3-fluoro-4-methylbenzoyl)-1-benzofuran-3-yl]amino]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[[2-(3-fluoro-4-methylbenzoyl)-1-benzofuran-3-yl]amino]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 110825664 |
| Molecular Formula | C25H20FNO4 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-[[2-(3-fluoro-4-methylbenzoyl)-1-benzofuran-3-yl]amino]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CNc2c(C(=O)c3ccc(C)c(F)c3)oc3ccccc23)cc1 |
| InChI | InChI=1S/C25H20FNO4/c1-15-7-8-17(13-20(15)26)24(29)25-23(19-5-3-4-6-22(19)31-25)27-14-21(28)16-9-11-18(30-2)12-10-16/h3-13,27H,14H2,1-2H3 |
| InChIKey | DGFHURLJUQDNOQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |