C25H19F2NO4 — CID 18848079
N-[2-(3-fluoro-4-methylbenzoyl)-1-benzofuran-3-yl]-2-(4-fluorophenoxy)propanamide (PubChem CID 18848079) has the molecular formula C25H19F2NO4 and a molecular weight of 435.43 g/mol. Its IUPAC name is N-[2-(3-fluoro-4-methylbenzoyl)-1-benzofuran-3-yl]-2-(4-fluorophenoxy)propanamide.
| Compound Name | N-[2-(3-fluoro-4-methylbenzoyl)-1-benzofuran-3-yl]-2-(4-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 18848079 |
| Molecular Formula | C25H19F2NO4 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[2-(3-fluoro-4-methylbenzoyl)-1-benzofuran-3-yl]-2-(4-fluorophenoxy)propanamide |
| SMILES | Cc1ccc(C(=O)c2oc3ccccc3c2NC(=O)C(C)Oc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C25H19F2NO4/c1-14-7-8-16(13-20(14)27)23(29)24-22(19-5-3-4-6-21(19)32-24)28-25(30)15(2)31-18-11-9-17(26)10-12-18/h3-13,15H,1-2H3,(H,28,30) |
| InChIKey | WGLPADWWTWDRJM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |