C25H19ClFNO5 — CID 18848000
N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-2-(4-fluorophenoxy)propanamide (PubChem CID 18848000) has the molecular formula C25H19ClFNO5 and a molecular weight of 467.88 g/mol. Its IUPAC name is N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-2-(4-fluorophenoxy)propanamide.
| Compound Name | N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-2-(4-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 18848000 |
| Molecular Formula | C25H19ClFNO5 |
| Molecular Weight | 467.88 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-[2-(3-chloro-4-methoxybenzoyl)-1-benzofuran-3-yl]-2-(4-fluorophenoxy)propanamide |
| SMILES | COc1ccc(C(=O)c2oc3ccccc3c2NC(=O)C(C)Oc2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C25H19ClFNO5/c1-14(32-17-10-8-16(27)9-11-17)25(30)28-22-18-5-3-4-6-20(18)33-24(22)23(29)15-7-12-21(31-2)19(26)13-15/h3-14H,1-2H3,(H,28,30) |
| InChIKey | MKXCJPBSONEMFU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.88 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |