C29H29NO5 — CID 3445869
2-(4-tert-butylphenoxy)-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]propanamide (PubChem CID 3445869) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]propanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]propanamide |
|---|---|
| PubChem CID | 3445869 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]propanamide |
| SMILES | COc1ccc(C(=O)c2oc3ccccc3c2NC(=O)C(C)Oc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H29NO5/c1-18(34-22-16-12-20(13-17-22)29(2,3)4)28(32)30-25-23-8-6-7-9-24(23)35-27(25)26(31)19-10-14-21(33-5)15-11-19/h6-18H,1-5H3,(H,30,32) |
| InChIKey | PVBPTBCDWWAUMD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |