C20H18BrNO3 — CID 4289356
N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]pentanamide (PubChem CID 4289356) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]pentanamide.
| Compound Name | N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]pentanamide |
|---|---|
| PubChem CID | 4289356 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[2-(4-bromobenzoyl)-1-benzofuran-3-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1c(C(=O)c2ccc(Br)cc2)oc2ccccc12 |
| InChI | InChI=1S/C20H18BrNO3/c1-2-3-8-17(23)22-18-15-6-4-5-7-16(15)25-20(18)19(24)13-9-11-14(21)12-10-13/h4-7,9-12H,2-3,8H2,1H3,(H,22,23) |
| InChIKey | RRQXJZLOOBAOMS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |