C22H25ClN2O2 — CID 110826934
N-(3-chlorophenyl)-3-(heptylamino)-1-benzofuran-2-carboxamide (PubChem CID 110826934) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(heptylamino)-1-benzofuran-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-(heptylamino)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 110826934 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-(3-chlorophenyl)-3-(heptylamino)-1-benzofuran-2-carboxamide |
| SMILES | CCCCCCCNc1c(C(=O)Nc2cccc(Cl)c2)oc2ccccc12 |
| InChI | InChI=1S/C22H25ClN2O2/c1-2-3-4-5-8-14-24-20-18-12-6-7-13-19(18)27-21(20)22(26)25-17-11-9-10-16(23)15-17/h6-7,9-13,15,24H,2-5,8,14H2,1H3,(H,25,26) |
| InChIKey | BDIGCXYOLKFASJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|