C23H23ClN2O3 — CID 7501810
N-(3-chlorophenyl)-3-[(2-cyclohexylacetyl)amino]-1-benzofuran-2-carboxamide (PubChem CID 7501810) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[(2-cyclohexylacetyl)amino]-1-benzofuran-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-[(2-cyclohexylacetyl)amino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7501810 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-(3-chlorophenyl)-3-[(2-cyclohexylacetyl)amino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(CC1CCCCC1)Nc1c(C(=O)Nc2cccc(Cl)c2)oc2ccccc12 |
| InChI | InChI=1S/C23H23ClN2O3/c24-16-9-6-10-17(14-16)25-23(28)22-21(18-11-4-5-12-19(18)29-22)26-20(27)13-15-7-2-1-3-8-15/h4-6,9-12,14-15H,1-3,7-8,13H2,(H,25,28)(H,26,27) |
| InChIKey | NTEBQEABACOTFA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |