C19H14ClFN2O3 — CID 7200191
N-(3-chloro-4-fluorophenyl)-3-(cyclopropanecarbonylamino)-1-benzofuran-2-carboxamide (PubChem CID 7200191) has the molecular formula C19H14ClFN2O3 and a molecular weight of 372.78 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-(cyclopropanecarbonylamino)-1-benzofuran-2-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-(cyclopropanecarbonylamino)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7200191 |
| Molecular Formula | C19H14ClFN2O3 |
| Molecular Weight | 372.78 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-(cyclopropanecarbonylamino)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1oc2ccccc2c1NC(=O)C1CC1 |
| InChI | InChI=1S/C19H14ClFN2O3/c20-13-9-11(7-8-14(13)21)22-19(25)17-16(23-18(24)10-5-6-10)12-3-1-2-4-15(12)26-17/h1-4,7-10H,5-6H2,(H,22,25)(H,23,24) |
| InChIKey | UJWCQQBSOBHPBU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.78 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |