C21H19FN2O3 — CID 3241032
3-(cyclopentanecarbonylamino)-N-(4-fluorophenyl)-1-benzofuran-2-carboxamide (PubChem CID 3241032) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is 3-(cyclopentanecarbonylamino)-N-(4-fluorophenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-(cyclopentanecarbonylamino)-N-(4-fluorophenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3241032 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-(cyclopentanecarbonylamino)-N-(4-fluorophenyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1oc2ccccc2c1NC(=O)C1CCCC1 |
| InChI | InChI=1S/C21H19FN2O3/c22-14-9-11-15(12-10-14)23-21(26)19-18(16-7-3-4-8-17(16)27-19)24-20(25)13-5-1-2-6-13/h3-4,7-13H,1-2,5-6H2,(H,23,26)(H,24,25) |
| InChIKey | FIMAKRJHNJHNAD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |