C26H28FN3O3 — CID 20925892
N-[2-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]cyclohexanecarboxamide (PubChem CID 20925892) has the molecular formula C26H28FN3O3 and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 20925892 |
| Molecular Formula | C26H28FN3O3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1c(C(=O)N2CCN(c3ccc(F)cc3)CC2)oc2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C26H28FN3O3/c27-19-10-12-20(13-11-19)29-14-16-30(17-15-29)26(32)24-23(21-8-4-5-9-22(21)33-24)28-25(31)18-6-2-1-3-7-18/h4-5,8-13,18H,1-3,6-7,14-17H2,(H,28,31) |
| InChIKey | KYBMYDFPCICVOD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |