C27H39N3O4 — CID 20925897
N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]cyclohexanecarboxamide (PubChem CID 20925897) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 20925897 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]cyclohexanecarboxamide |
| SMILES | CCOCCCN(C)C1CCN(C(=O)c2oc3ccccc3c2NC(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C27H39N3O4/c1-3-33-19-9-16-29(2)21-14-17-30(18-15-21)27(32)25-24(22-12-7-8-13-23(22)34-25)28-26(31)20-10-5-4-6-11-20/h7-8,12-13,20-21H,3-6,9-11,14-19H2,1-2H3,(H,28,31) |
| InChIKey | VJPCPSYMBLRDMQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|