C22H23N3O6 — CID 20925927
2-ethoxy-N-[2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]acetamide (PubChem CID 20925927) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]acetamide.
| Compound Name | 2-ethoxy-N-[2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]acetamide |
|---|---|
| PubChem CID | 20925927 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-ethoxy-N-[2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]acetamide |
| SMILES | CCOCC(=O)Nc1c(C(=O)N2CCN(C(=O)c3ccco3)CC2)oc2ccccc12 |
| InChI | InChI=1S/C22H23N3O6/c1-2-29-14-18(26)23-19-15-6-3-4-7-16(15)31-20(19)22(28)25-11-9-24(10-12-25)21(27)17-8-5-13-30-17/h3-8,13H,2,9-12,14H2,1H3,(H,23,26) |
| InChIKey | ZEXNKXIVDNLHMR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |