C22H22N2O5 — CID 20926220
2-ethoxy-N-[2-(morpholine-4-carbonyl)-1-benzofuran-3-yl]benzamide (PubChem CID 20926220) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-ethoxy-N-[2-(morpholine-4-carbonyl)-1-benzofuran-3-yl]benzamide.
| Compound Name | 2-ethoxy-N-[2-(morpholine-4-carbonyl)-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 20926220 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-ethoxy-N-[2-(morpholine-4-carbonyl)-1-benzofuran-3-yl]benzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1c(C(=O)N2CCOCC2)oc2ccccc12 |
| InChI | InChI=1S/C22H22N2O5/c1-2-28-17-9-5-4-8-16(17)21(25)23-19-15-7-3-6-10-18(15)29-20(19)22(26)24-11-13-27-14-12-24/h3-10H,2,11-14H2,1H3,(H,23,25) |
| InChIKey | VATCURUTVPDSNJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |