C26H23N3O6 — CID 20925969
N-[2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]-2-methoxybenzamide (PubChem CID 20925969) has the molecular formula C26H23N3O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is N-[2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]-2-methoxybenzamide.
| Compound Name | N-[2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 20925969 |
| Molecular Formula | C26H23N3O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-[2-[4-(furan-2-carbonyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1c(C(=O)N2CCN(C(=O)c3ccco3)CC2)oc2ccccc12 |
| InChI | InChI=1S/C26H23N3O6/c1-33-19-9-4-3-8-18(19)24(30)27-22-17-7-2-5-10-20(17)35-23(22)26(32)29-14-12-28(13-15-29)25(31)21-11-6-16-34-21/h2-11,16H,12-15H2,1H3,(H,27,30) |
| InChIKey | OSJWXPMGZDILRB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |