C28H27N3O4 — CID 20925865
N-[2-[4-(3-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]-2-methylbenzamide (PubChem CID 20925865) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[2-[4-(3-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]-2-methylbenzamide.
| Compound Name | N-[2-[4-(3-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 20925865 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[2-[4-(3-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]-2-methylbenzamide |
| SMILES | COc1cccc(N2CCN(C(=O)c3oc4ccccc4c3NC(=O)c3ccccc3C)CC2)c1 |
| InChI | InChI=1S/C28H27N3O4/c1-19-8-3-4-11-22(19)27(32)29-25-23-12-5-6-13-24(23)35-26(25)28(33)31-16-14-30(15-17-31)20-9-7-10-21(18-20)34-2/h3-13,18H,14-17H2,1-2H3,(H,29,32) |
| InChIKey | YYGQGEXSCYCUPN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |