C27H24FN3O4 — CID 20925911
4-fluoro-N-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]benzamide (PubChem CID 20925911) has the molecular formula C27H24FN3O4 and a molecular weight of 473.50 g/mol. Its IUPAC name is 4-fluoro-N-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]benzamide.
| Compound Name | 4-fluoro-N-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 20925911 |
| Molecular Formula | C27H24FN3O4 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 4-fluoro-N-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1-benzofuran-3-yl]benzamide |
| SMILES | COc1ccc(N2CCN(C(=O)c3oc4ccccc4c3NC(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H24FN3O4/c1-34-21-12-10-20(11-13-21)30-14-16-31(17-15-30)27(33)25-24(22-4-2-3-5-23(22)35-25)29-26(32)18-6-8-19(28)9-7-18/h2-13H,14-17H2,1H3,(H,29,32) |
| InChIKey | IGXVMFRDWLHQBO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|