C18H21N3O5 — CID 20506465
N-(2,3-dimethoxyphenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide (PubChem CID 20506465) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is N-(2,3-dimethoxyphenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-(2,3-dimethoxyphenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 20506465 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-(2,3-dimethoxyphenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide |
| SMILES | COc1cccc(NC(=O)N2CCN(C(=O)c3ccco3)CC2)c1OC |
| InChI | InChI=1S/C18H21N3O5/c1-24-14-6-3-5-13(16(14)25-2)19-18(23)21-10-8-20(9-11-21)17(22)15-7-4-12-26-15/h3-7,12H,8-11H2,1-2H3,(H,19,23) |
| InChIKey | BMWLXNDQIZNNCP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |