C18H20BrN3O4 — CID 60590217
N-(4-bromo-2-methoxy-6-methylphenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide (PubChem CID 60590217) has the molecular formula C18H20BrN3O4 and a molecular weight of 422.28 g/mol. Its IUPAC name is N-(4-bromo-2-methoxy-6-methylphenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-(4-bromo-2-methoxy-6-methylphenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60590217 |
| Molecular Formula | C18H20BrN3O4 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | N-(4-bromo-2-methoxy-6-methylphenyl)-4-(furan-2-carbonyl)piperazine-1-carboxamide |
| SMILES | COc1cc(Br)cc(C)c1NC(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H20BrN3O4/c1-12-10-13(19)11-15(25-2)16(12)20-18(24)22-7-5-21(6-8-22)17(23)14-4-3-9-26-14/h3-4,9-11H,5-8H2,1-2H3,(H,20,24) |
| InChIKey | HKMDSHVMFKWRCW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |