C27H31N3O4 — CID 20925967
2-methoxy-N-[2-(4-piperidin-1-ylpiperidine-1-carbonyl)-1-benzofuran-3-yl]benzamide (PubChem CID 20925967) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-methoxy-N-[2-(4-piperidin-1-ylpiperidine-1-carbonyl)-1-benzofuran-3-yl]benzamide.
| Compound Name | 2-methoxy-N-[2-(4-piperidin-1-ylpiperidine-1-carbonyl)-1-benzofuran-3-yl]benzamide |
|---|---|
| PubChem CID | 20925967 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-methoxy-N-[2-(4-piperidin-1-ylpiperidine-1-carbonyl)-1-benzofuran-3-yl]benzamide |
| SMILES | COc1ccccc1C(=O)Nc1c(C(=O)N2CCC(N3CCCCC3)CC2)oc2ccccc12 |
| InChI | InChI=1S/C27H31N3O4/c1-33-22-11-5-4-10-21(22)26(31)28-24-20-9-3-6-12-23(20)34-25(24)27(32)30-17-13-19(14-18-30)29-15-7-2-8-16-29/h3-6,9-12,19H,2,7-8,13-18H2,1H3,(H,28,31) |
| InChIKey | ZFAXIJNEHJONAE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |