C28H34FN3O4 — CID 20925820
N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]-2-(4-fluorophenyl)acetamide (PubChem CID 20925820) has the molecular formula C28H34FN3O4 and a molecular weight of 495.60 g/mol. Its IUPAC name is N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 20925820 |
| Molecular Formula | C28H34FN3O4 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]-2-(4-fluorophenyl)acetamide |
| SMILES | CCOCCCN(C)C1CCN(C(=O)c2oc3ccccc3c2NC(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H34FN3O4/c1-3-35-18-6-15-31(2)22-13-16-32(17-14-22)28(34)27-26(23-7-4-5-8-24(23)36-27)30-25(33)19-20-9-11-21(29)12-10-20/h4-5,7-12,22H,3,6,13-19H2,1-2H3,(H,30,33) |
| InChIKey | OMXJFUOCLDBLMA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|