C27H32FN3O4 — CID 20925789
N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]-2-fluorobenzamide (PubChem CID 20925789) has the molecular formula C27H32FN3O4 and a molecular weight of 481.57 g/mol. Its IUPAC name is N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]-2-fluorobenzamide.
| Compound Name | N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 20925789 |
| Molecular Formula | C27H32FN3O4 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]-2-fluorobenzamide |
| SMILES | CCOCCCN(C)C1CCN(C(=O)c2oc3ccccc3c2NC(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H32FN3O4/c1-3-34-18-8-15-30(2)19-13-16-31(17-14-19)27(33)25-24(21-10-5-7-12-23(21)35-25)29-26(32)20-9-4-6-11-22(20)28/h4-7,9-12,19H,3,8,13-18H2,1-2H3,(H,29,32) |
| InChIKey | PUHHIIYKLUSLLJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|