C24H33N3O4 — CID 20925775
N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]cyclopropanecarboxamide (PubChem CID 20925775) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 20925775 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-[2-[4-[3-ethoxypropyl(methyl)amino]piperidine-1-carbonyl]-1-benzofuran-3-yl]cyclopropanecarboxamide |
| SMILES | CCOCCCN(C)C1CCN(C(=O)c2oc3ccccc3c2NC(=O)C2CC2)CC1 |
| InChI | InChI=1S/C24H33N3O4/c1-3-30-16-6-13-26(2)18-11-14-27(15-12-18)24(29)22-21(25-23(28)17-9-10-17)19-7-4-5-8-20(19)31-22/h4-5,7-8,17-18H,3,6,9-16H2,1-2H3,(H,25,28) |
| InChIKey | WXLCRRXJNOBLBW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|