C23H28FN3O — CID 648152
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]phenyl]cyclohexanecarboxamide (PubChem CID 648152) has the molecular formula C23H28FN3O and a molecular weight of 381.49 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 648152 |
| Molecular Formula | C23H28FN3O |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccccc1N1CCN(c2ccc(F)cc2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C23H28FN3O/c24-19-10-12-20(13-11-19)26-14-16-27(17-15-26)22-9-5-4-8-21(22)25-23(28)18-6-2-1-3-7-18/h4-5,8-13,18H,1-3,6-7,14-17H2,(H,25,28) |
| InChIKey | SYOVHAWDOLJOAN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |