C25H31FN4O2 — CID 24535038
N-[2-(4-ethylpiperazin-1-yl)phenyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide (PubChem CID 24535038) has the molecular formula C25H31FN4O2 and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)phenyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 24535038 |
| Molecular Formula | C25H31FN4O2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)phenyl]-1-(4-fluorobenzoyl)piperidine-3-carboxamide |
| SMILES | CCN1CCN(c2ccccc2NC(=O)C2CCCN(C(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C25H31FN4O2/c1-2-28-14-16-29(17-15-28)23-8-4-3-7-22(23)27-24(31)20-6-5-13-30(18-20)25(32)19-9-11-21(26)12-10-19/h3-4,7-12,20H,2,5-6,13-18H2,1H3,(H,27,31) |
| InChIKey | BJEWFMNFIKBLNH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |