C28H36N4O2 — CID 60596479
1-N,3-N-bis(2-pyrrolidin-1-ylphenyl)cyclohexane-1,3-dicarboxamide (PubChem CID 60596479) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-N,3-N-bis(2-pyrrolidin-1-ylphenyl)cyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-pyrrolidin-1-ylphenyl)cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 60596479 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 1-N,3-N-bis(2-pyrrolidin-1-ylphenyl)cyclohexane-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccccc1N1CCCC1)C1CCCC(C(=O)Nc2ccccc2N2CCCC2)C1 |
| InChI | InChI=1S/C28H36N4O2/c33-27(29-23-12-1-3-14-25(23)31-16-5-6-17-31)21-10-9-11-22(20-21)28(34)30-24-13-2-4-15-26(24)32-18-7-8-19-32/h1-4,12-15,21-22H,5-11,16-20H2,(H,29,33)(H,30,34) |
| InChIKey | YTSDVPWENGUKJD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |