C24H26N2O3 — CID 7159624
3-(3-cyclohexylpropanoylamino)-N-phenyl-1-benzofuran-2-carboxamide (PubChem CID 7159624) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 3-(3-cyclohexylpropanoylamino)-N-phenyl-1-benzofuran-2-carboxamide.
| Compound Name | 3-(3-cyclohexylpropanoylamino)-N-phenyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7159624 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-(3-cyclohexylpropanoylamino)-N-phenyl-1-benzofuran-2-carboxamide |
| SMILES | O=C(CCC1CCCCC1)Nc1c(C(=O)Nc2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C24H26N2O3/c27-21(16-15-17-9-3-1-4-10-17)26-22-19-13-7-8-14-20(19)29-23(22)24(28)25-18-11-5-2-6-12-18/h2,5-8,11-14,17H,1,3-4,9-10,15-16H2,(H,25,28)(H,26,27) |
| InChIKey | DRCDGOOGYUHGJQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |