C21H25NO6 — CID 5019604
ethyl 3-[[2-(3-cyclopentylpropanoyloxy)acetyl]amino]-1-benzofuran-2-carboxylate (PubChem CID 5019604) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is ethyl 3-[[2-(3-cyclopentylpropanoyloxy)acetyl]amino]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[[2-(3-cyclopentylpropanoyloxy)acetyl]amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 5019604 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | ethyl 3-[[2-(3-cyclopentylpropanoyloxy)acetyl]amino]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1NC(=O)COC(=O)CCC1CCCC1 |
| InChI | InChI=1S/C21H25NO6/c1-2-26-21(25)20-19(15-9-5-6-10-16(15)28-20)22-17(23)13-27-18(24)12-11-14-7-3-4-8-14/h5-6,9-10,14H,2-4,7-8,11-13H2,1H3,(H,22,23) |
| InChIKey | OVLMDYKJXYOYQG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |