C25H21NO4 — CID 4642144
ethyl 3-[(2,2-diphenylacetyl)amino]-1-benzofuran-2-carboxylate (PubChem CID 4642144) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 3-[(2,2-diphenylacetyl)amino]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[(2,2-diphenylacetyl)amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 4642144 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | ethyl 3-[(2,2-diphenylacetyl)amino]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21NO4/c1-2-29-25(28)23-22(19-15-9-10-16-20(19)30-23)26-24(27)21(17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-16,21H,2H2,1H3,(H,26,27) |
| InChIKey | DFNMWQKBWYTPRV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |