C18H13Cl2NO4 — CID 7117042
ethyl 3-[(2,4-dichlorobenzoyl)amino]-1-benzofuran-2-carboxylate (PubChem CID 7117042) has the molecular formula C18H13Cl2NO4 and a molecular weight of 378.21 g/mol. Its IUPAC name is ethyl 3-[(2,4-dichlorobenzoyl)amino]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[(2,4-dichlorobenzoyl)amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7117042 |
| Molecular Formula | C18H13Cl2NO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | ethyl 3-[(2,4-dichlorobenzoyl)amino]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2NO4/c1-2-24-18(23)16-15(12-5-3-4-6-14(12)25-16)21-17(22)11-8-7-10(19)9-13(11)20/h3-9H,2H2,1H3,(H,21,22) |
| InChIKey | LMECSTWZZPMWSZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |