C20H19NO4S — CID 4250174
ethyl 3-(3-phenylsulfanylpropanoylamino)-1-benzofuran-2-carboxylate (PubChem CID 4250174) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is ethyl 3-(3-phenylsulfanylpropanoylamino)-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-(3-phenylsulfanylpropanoylamino)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 4250174 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | ethyl 3-(3-phenylsulfanylpropanoylamino)-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1NC(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C20H19NO4S/c1-2-24-20(23)19-18(15-10-6-7-11-16(15)25-19)21-17(22)12-13-26-14-8-4-3-5-9-14/h3-11H,2,12-13H2,1H3,(H,21,22) |
| InChIKey | LIXCUWRSJCKAIF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |