C19H17NO4 — CID 52943074
methyl 3-(3-phenylpropanoylamino)-1-benzofuran-2-carboxylate (PubChem CID 52943074) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is methyl 3-(3-phenylpropanoylamino)-1-benzofuran-2-carboxylate.
| Compound Name | methyl 3-(3-phenylpropanoylamino)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 52943074 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | methyl 3-(3-phenylpropanoylamino)-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)c1oc2ccccc2c1NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H17NO4/c1-23-19(22)18-17(14-9-5-6-10-15(14)24-18)20-16(21)12-11-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,20,21) |
| InChIKey | URHWCSWZWOQZLF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |